C12H13FN4O — CID 80798211
4-[2-[(2-amino-5-fluoropyrimidin-4-yl)amino]ethyl]phenol (PubChem CID 80798211) has the molecular formula C12H13FN4O and a molecular weight of 248.26 g/mol. Its IUPAC name is 4-[2-[(2-amino-5-fluoropyrimidin-4-yl)amino]ethyl]phenol.
| Compound Name | 4-[2-[(2-amino-5-fluoropyrimidin-4-yl)amino]ethyl]phenol |
|---|---|
| PubChem CID | 80798211 |
| Molecular Formula | C12H13FN4O |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 4-[2-[(2-amino-5-fluoropyrimidin-4-yl)amino]ethyl]phenol |
| SMILES | Nc1ncc(F)c(NCCc2ccc(O)cc2)n1 |
| InChI | InChI=1S/C12H13FN4O/c13-10-7-16-12(14)17-11(10)15-6-5-8-1-3-9(18)4-2-8/h1-4,7,18H,5-6H2,(H3,14,15,16,17) |
| InChIKey | BJHCAKXRBNABMS-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |