C6H11N3O3S2 — CID 131020862
2-[[(2S)-1-hydroxypropan-2-yl]amino]-1,3-thiazole-5-sulfonamide (PubChem CID 131020862) has the molecular formula C6H11N3O3S2 and a molecular weight of 237.31 g/mol. Its IUPAC name is 2-[[(2S)-1-hydroxypropan-2-yl]amino]-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-[[(2S)-1-hydroxypropan-2-yl]amino]-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 131020862 |
| Molecular Formula | C6H11N3O3S2 |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | 2-[[(2S)-1-hydroxypropan-2-yl]amino]-1,3-thiazole-5-sulfonamide |
| SMILES | C[C@@H](CO)Nc1ncc(S(N)(=O)=O)s1 |
| InChI | InChI=1S/C6H11N3O3S2/c1-4(3-10)9-6-8-2-5(13-6)14(7,11)12/h2,4,10H,3H2,1H3,(H,8,9)(H2,7,11,12)/t4-/m0/s1 |
| InChIKey | GESFVTOSGMBJCB-BYPYZUCNSA-N |
| XLogP | -0.42 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |