C12H22N2O — CID 175901419
3-nonan-2-yl-1,2-oxazol-4-amine (PubChem CID 175901419) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is 3-nonan-2-yl-1,2-oxazol-4-amine.
| Compound Name | 3-nonan-2-yl-1,2-oxazol-4-amine |
|---|---|
| PubChem CID | 175901419 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | 3-nonan-2-yl-1,2-oxazol-4-amine |
| SMILES | CCCCCCCC(C)c1nocc1N |
| InChI | InChI=1S/C12H22N2O/c1-3-4-5-6-7-8-10(2)12-11(13)9-15-14-12/h9-10H,3-8,13H2,1-2H3 |
| InChIKey | KNZBBIMEIFPPHF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|