C17H31NO — CID 170386435
4-dodecan-5-yl-3,5-dimethyl-1,2-oxazole (PubChem CID 170386435) has the molecular formula C17H31NO and a molecular weight of 265.44 g/mol. Its IUPAC name is 4-dodecan-5-yl-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-dodecan-5-yl-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 170386435 |
| Molecular Formula | C17H31NO |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.24 |
| IUPAC Name | 4-dodecan-5-yl-3,5-dimethyl-1,2-oxazole |
| SMILES | CCCCCCCC(CCCC)c1c(C)noc1C |
| InChI | InChI=1S/C17H31NO/c1-5-7-9-10-11-13-16(12-8-6-2)17-14(3)18-19-15(17)4/h16H,5-13H2,1-4H3 |
| InChIKey | CXGKYUNKOWLJBS-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|