C13H24N2O — CID 115896745
N-[1-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]pentan-3-amine (PubChem CID 115896745) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is N-[1-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]pentan-3-amine.
| Compound Name | N-[1-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]pentan-3-amine |
|---|---|
| PubChem CID | 115896745 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | N-[1-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]pentan-3-amine |
| SMILES | CCC(CC)NC(CC)c1c(C)noc1C |
| InChI | InChI=1S/C13H24N2O/c1-6-11(7-2)14-12(8-3)13-9(4)15-16-10(13)5/h11-12,14H,6-8H2,1-5H3 |
| InChIKey | UHBPBFQRSQCCSH-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |