C12H20N2O2 — CID 115896742
N-[1-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]oxolan-3-amine (PubChem CID 115896742) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is N-[1-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]oxolan-3-amine.
| Compound Name | N-[1-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]oxolan-3-amine |
|---|---|
| PubChem CID | 115896742 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | N-[1-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]oxolan-3-amine |
| SMILES | CCC(NC1CCOC1)c1c(C)noc1C |
| InChI | InChI=1S/C12H20N2O2/c1-4-11(13-10-5-6-15-7-10)12-8(2)14-16-9(12)3/h10-11,13H,4-7H2,1-3H3 |
| InChIKey | LSMILFBMAWTRQK-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |