C23H25N3 — CID 142247031
2-heptan-2-yl-6-naphthalen-1-yl-1H-imidazo[4,5-b]pyridine (PubChem CID 142247031) has the molecular formula C23H25N3 and a molecular weight of 343.47 g/mol. Its IUPAC name is 2-heptan-2-yl-6-naphthalen-1-yl-1H-imidazo[4,5-b]pyridine.
| Compound Name | 2-heptan-2-yl-6-naphthalen-1-yl-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 142247031 |
| Molecular Formula | C23H25N3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | 2-heptan-2-yl-6-naphthalen-1-yl-1H-imidazo[4,5-b]pyridine |
| SMILES | CCCCCC(C)c1nc2ncc(-c3cccc4ccccc34)cc2[nH]1 |
| InChI | InChI=1S/C23H25N3/c1-3-4-5-9-16(2)22-25-21-14-18(15-24-23(21)26-22)20-13-8-11-17-10-6-7-12-19(17)20/h6-8,10-16H,3-5,9H2,1-2H3,(H,24,25,26) |
| InChIKey | QIZRFDFPODGRLQ-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|