C22H14ClN3 — CID 23025637
2-(3-chlorophenyl)-6-naphthalen-1-yl-1H-imidazo[4,5-b]pyridine (PubChem CID 23025637) has the molecular formula C22H14ClN3 and a molecular weight of 355.83 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-6-naphthalen-1-yl-1H-imidazo[4,5-b]pyridine.
| Compound Name | 2-(3-chlorophenyl)-6-naphthalen-1-yl-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 23025637 |
| Molecular Formula | C22H14ClN3 |
| Molecular Weight | 355.83 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 2-(3-chlorophenyl)-6-naphthalen-1-yl-1H-imidazo[4,5-b]pyridine |
| SMILES | Clc1cccc(-c2nc3ncc(-c4cccc5ccccc45)cc3[nH]2)c1 |
| InChI | InChI=1S/C22H14ClN3/c23-17-8-3-7-15(11-17)21-25-20-12-16(13-24-22(20)26-21)19-10-4-6-14-5-1-2-9-18(14)19/h1-13H,(H,24,25,26) |
| InChIKey | KGWPRTBLOARSFL-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.83 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |