C44H80S2 — CID 158088922
3,4-bis[(2S)-2-methyloctyl]thiophene;3,4-bis[(2R)-2-methyloctyl]thiophene (PubChem CID 158088922) has the molecular formula C44H80S2 and a molecular weight of 673.26 g/mol. Its IUPAC name is 3,4-bis[(2S)-2-methyloctyl]thiophene;3,4-bis[(2R)-2-methyloctyl]thiophene.
| Compound Name | 3,4-bis[(2S)-2-methyloctyl]thiophene;3,4-bis[(2R)-2-methyloctyl]thiophene |
|---|---|
| PubChem CID | 158088922 |
| Molecular Formula | C44H80S2 |
| Molecular Weight | 673.26 g/mol |
| Exact Mass | 672.57 |
| IUPAC Name | 3,4-bis[(2S)-2-methyloctyl]thiophene;3,4-bis[(2R)-2-methyloctyl]thiophene |
| SMILES | CCCCCC[C@@H](C)Cc1cscc1C[C@H](C)CCCCCC.CCCCCC[C@H](C)Cc1cscc1C[C@@H](C)CCCCCC |
| InChI | InChI=1S/2C22H40S/c2*1-5-7-9-11-13-19(3)15-21-17-23-18-22(21)16-20(4)14-12-10-8-6-2/h2*17-20H,5-16H2,1-4H3/t2*19-,20-/m10/s1 |
| InChIKey | FNVWISUSSWVZSS-WKZUIDESSA-N |
| XLogP | 16.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.26 |
| LogP ≤ 5 | 16.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|