C6H7ClF3N3O3S — CID 103213784
5-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-1,2,4-triazole-3-sulfonyl chloride (PubChem CID 103213784) has the molecular formula C6H7ClF3N3O3S and a molecular weight of 293.65 g/mol. Its IUPAC name is 5-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-1,2,4-triazole-3-sulfonyl chloride.
| Compound Name | 5-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-1,2,4-triazole-3-sulfonyl chloride |
|---|---|
| PubChem CID | 103213784 |
| Molecular Formula | C6H7ClF3N3O3S |
| Molecular Weight | 293.65 g/mol |
| Exact Mass | 292.98 |
| IUPAC Name | 5-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-1,2,4-triazole-3-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1n[nH]c(CCOCC(F)(F)F)n1 |
| InChI | InChI=1S/C6H7ClF3N3O3S/c7-17(14,15)5-11-4(12-13-5)1-2-16-3-6(8,9)10/h1-3H2,(H,11,12,13) |
| InChIKey | PAEFKKANBAWPIE-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.65 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|