C17H31N3 — CID 65427882
3-cyclohexyl-5-nonyl-1H-1,2,4-triazole (PubChem CID 65427882) has the molecular formula C17H31N3 and a molecular weight of 277.46 g/mol. Its IUPAC name is 3-cyclohexyl-5-nonyl-1H-1,2,4-triazole.
| Compound Name | 3-cyclohexyl-5-nonyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 65427882 |
| Molecular Formula | C17H31N3 |
| Molecular Weight | 277.46 g/mol |
| Exact Mass | 277.25 |
| IUPAC Name | 3-cyclohexyl-5-nonyl-1H-1,2,4-triazole |
| SMILES | CCCCCCCCCc1nc(C2CCCCC2)n[nH]1 |
| InChI | InChI=1S/C17H31N3/c1-2-3-4-5-6-7-11-14-16-18-17(20-19-16)15-12-9-8-10-13-15/h15H,2-14H2,1H3,(H,18,19,20) |
| InChIKey | YXRUZPNSAMANIP-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.46 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|