C13H21N3 — CID 103164429
5-(cyclobutylmethyl)-3-cyclohexyl-1H-1,2,4-triazole (PubChem CID 103164429) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 5-(cyclobutylmethyl)-3-cyclohexyl-1H-1,2,4-triazole.
| Compound Name | 5-(cyclobutylmethyl)-3-cyclohexyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 103164429 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 5-(cyclobutylmethyl)-3-cyclohexyl-1H-1,2,4-triazole |
| SMILES | C1CCC(c2n[nH]c(CC3CCC3)n2)CC1 |
| InChI | InChI=1S/C13H21N3/c1-2-7-11(8-3-1)13-14-12(15-16-13)9-10-5-4-6-10/h10-11H,1-9H2,(H,14,15,16) |
| InChIKey | IXSVEDCTIKTKBX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |