C13H23N5 — CID 55058169
1-[(3-cyclohexyl-1H-1,2,4-triazol-5-yl)methyl]piperazine (PubChem CID 55058169) has the molecular formula C13H23N5 and a molecular weight of 249.36 g/mol. Its IUPAC name is 1-[(3-cyclohexyl-1H-1,2,4-triazol-5-yl)methyl]piperazine.
| Compound Name | 1-[(3-cyclohexyl-1H-1,2,4-triazol-5-yl)methyl]piperazine |
|---|---|
| PubChem CID | 55058169 |
| Molecular Formula | C13H23N5 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.20 |
| IUPAC Name | 1-[(3-cyclohexyl-1H-1,2,4-triazol-5-yl)methyl]piperazine |
| SMILES | C1CCC(c2n[nH]c(CN3CCNCC3)n2)CC1 |
| InChI | InChI=1S/C13H23N5/c1-2-4-11(5-3-1)13-15-12(16-17-13)10-18-8-6-14-7-9-18/h11,14H,1-10H2,(H,15,16,17) |
| InChIKey | UBCYSBGLMXWAKQ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |