C8H12ClN3 — CID 130848106
3-chloro-5-(cyclopentylmethyl)-1H-1,2,4-triazole (PubChem CID 130848106) has the molecular formula C8H12ClN3 and a molecular weight of 185.66 g/mol. Its IUPAC name is 3-chloro-5-(cyclopentylmethyl)-1H-1,2,4-triazole.
| Compound Name | 3-chloro-5-(cyclopentylmethyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 130848106 |
| Molecular Formula | C8H12ClN3 |
| Molecular Weight | 185.66 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 3-chloro-5-(cyclopentylmethyl)-1H-1,2,4-triazole |
| SMILES | Clc1n[nH]c(CC2CCCC2)n1 |
| InChI | InChI=1S/C8H12ClN3/c9-8-10-7(11-12-8)5-6-3-1-2-4-6/h6H,1-5H2,(H,10,11,12) |
| InChIKey | BFAHWTXVOMPVEF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.66 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |