C15H19N3 — CID 61353981
5-(cyclohexylmethyl)-3-phenyl-1H-1,2,4-triazole (PubChem CID 61353981) has the molecular formula C15H19N3 and a molecular weight of 241.34 g/mol. Its IUPAC name is 5-(cyclohexylmethyl)-3-phenyl-1H-1,2,4-triazole.
| Compound Name | 5-(cyclohexylmethyl)-3-phenyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 61353981 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 5-(cyclohexylmethyl)-3-phenyl-1H-1,2,4-triazole |
| SMILES | c1ccc(-c2n[nH]c(CC3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C15H19N3/c1-3-7-12(8-4-1)11-14-16-15(18-17-14)13-9-5-2-6-10-13/h2,5-6,9-10,12H,1,3-4,7-8,11H2,(H,16,17,18) |
| InChIKey | PHDJEQKNUTVXFZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |