C15H20N4 — CID 62216718
2-[2-(3-phenyl-1H-1,2,4-triazol-5-yl)ethyl]piperidine (PubChem CID 62216718) has the molecular formula C15H20N4 and a molecular weight of 256.35 g/mol. Its IUPAC name is 2-[2-(3-phenyl-1H-1,2,4-triazol-5-yl)ethyl]piperidine.
| Compound Name | 2-[2-(3-phenyl-1H-1,2,4-triazol-5-yl)ethyl]piperidine |
|---|---|
| PubChem CID | 62216718 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 2-[2-(3-phenyl-1H-1,2,4-triazol-5-yl)ethyl]piperidine |
| SMILES | c1ccc(-c2n[nH]c(CCC3CCCCN3)n2)cc1 |
| InChI | InChI=1S/C15H20N4/c1-2-6-12(7-3-1)15-17-14(18-19-15)10-9-13-8-4-5-11-16-13/h1-3,6-7,13,16H,4-5,8-11H2,(H,17,18,19) |
| InChIKey | YPHWWXSIIFWXBH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |