About hydron;7-(2-piperidin-2-ylethyl)azepin-2-imine;dihydrochloride
hydron;7-(2-piperidin-2-ylethyl)azepin-2-imine;dihydrochloride (PubChem CID 174347735) has the molecular formula C13H22Cl2N3+
and a molecular weight of 291.25 g/mol. Its IUPAC name is hydron;7-(2-piperidin-2-ylethyl)azepin-2-imine;dihydrochloride.
Molecular Properties
| Compound Name | hydron;7-(2-piperidin-2-ylethyl)azepin-2-imine;dihydrochloride |
| PubChem CID | 174347735 |
| Molecular Formula | C13H22Cl2N3+ |
| Molecular Weight | 291.25 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | hydron;7-(2-piperidin-2-ylethyl)azepin-2-imine;dihydrochloride |
| SMILES | Cl.Cl.[H+].[H]/N=c1\ccccc(CCC2CCCCN2)n1 |
| InChI | InChI=1S/C13H19N3.2ClH/c14-13-7-2-1-6-12(16-13)9-8-11-5-3-4-10-15-11;;/h1-2,6-7,11,14-15H,3-5,8-10H2;2*1H/p+1/b14-13+;; |
| InChIKey | RBWWOTDLSTYMSE-QDBORUFSSA-O |
| XLogP | 2.59 |
| TPSA | 48.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.25 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze hydron;7-(2-piperidin-2-ylethyl)azepin-2-imine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;7-(2-piperidin-2-ylethyl)azepin-2-imine;dihydrochloride?
The IUPAC name of hydron;7-(2-piperidin-2-ylethyl)azepin-2-imine;dihydrochloride (CID 174347735) is hydron;7-(2-piperidin-2-ylethyl)azepin-2-imine;dihydrochloride.
What is the SMILES notation for hydron;7-(2-piperidin-2-ylethyl)azepin-2-imine;dihydrochloride?
The canonical SMILES for hydron;7-(2-piperidin-2-ylethyl)azepin-2-imine;dihydrochloride is Cl.Cl.[H+].[H]/N=c1\ccccc(CCC2CCCCN2)n1.
What is the InChIKey of hydron;7-(2-piperidin-2-ylethyl)azepin-2-imine;dihydrochloride?
The InChIKey is RBWWOTDLSTYMSE-QDBORUFSSA-O. The full InChI is InChI=1S/C13H19N3.2ClH/c14-13-7-2-1-6-12(16-13)9-8-11-5-3-4-10-15-11;;/h1-2,6-7,11,14-15H,3-5,8-10H2;2*1H/p+1/b14-13+;;.
What are the key properties of hydron;7-(2-piperidin-2-ylethyl)azepin-2-imine;dihydrochloride?
hydron;7-(2-piperidin-2-ylethyl)azepin-2-imine;dihydrochloride has a molecular weight of 291.25 g/mol, XLogP of 2.59, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;7-(2-piperidin-2-ylethyl)azepin-2-imine;dihydrochloride is sourced from PubChem (CID 174347735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).