C13H21Cl2N3 — CID 141039441
3-(2-piperidin-2-ylethyl)azepin-2-imine;dihydrochloride (PubChem CID 141039441) has the molecular formula C13H21Cl2N3 and a molecular weight of 290.24 g/mol. Its IUPAC name is 3-(2-piperidin-2-ylethyl)azepin-2-imine;dihydrochloride.
| Compound Name | 3-(2-piperidin-2-ylethyl)azepin-2-imine;dihydrochloride |
|---|---|
| PubChem CID | 141039441 |
| Molecular Formula | C13H21Cl2N3 |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 3-(2-piperidin-2-ylethyl)azepin-2-imine;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=c1\nccccc1CCC1CCCCN1 |
| InChI | InChI=1S/C13H19N3.2ClH/c14-13-11(5-1-3-10-16-13)7-8-12-6-2-4-9-15-12;;/h1,3,5,10,12,14-15H,2,4,6-9H2;2*1H/b14-13-;; |
| InChIKey | UDSBCNLSBCOLBU-HLBFIJABSA-N |
| XLogP | 2.48 |
| TPSA | 48.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |