About 4-[5-(2-phenylethyl)-1H-1,2,4-triazol-3-yl]aniline
4-[5-(2-phenylethyl)-1H-1,2,4-triazol-3-yl]aniline (PubChem CID 82568521) has the molecular formula C16H16N4
and a molecular weight of 264.33 g/mol. Its IUPAC name is 4-[5-(2-phenylethyl)-1H-1,2,4-triazol-3-yl]aniline.
Molecular Properties
| Compound Name | 4-[5-(2-phenylethyl)-1H-1,2,4-triazol-3-yl]aniline |
| PubChem CID | 82568521 |
| Molecular Formula | C16H16N4 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 4-[5-(2-phenylethyl)-1H-1,2,4-triazol-3-yl]aniline |
| SMILES | Nc1ccc(-c2n[nH]c(CCc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C16H16N4/c17-14-9-7-13(8-10-14)16-18-15(19-20-16)11-6-12-4-2-1-3-5-12/h1-5,7-10H,6,11,17H2,(H,18,19,20) |
| InChIKey | PLGXZEAIABQIIA-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[5-(2-phenylethyl)-1H-1,2,4-triazol-3-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(2-phenylethyl)-1H-1,2,4-triazol-3-yl]aniline?
The IUPAC name of 4-[5-(2-phenylethyl)-1H-1,2,4-triazol-3-yl]aniline (CID 82568521) is 4-[5-(2-phenylethyl)-1H-1,2,4-triazol-3-yl]aniline.
What is the SMILES notation for 4-[5-(2-phenylethyl)-1H-1,2,4-triazol-3-yl]aniline?
The canonical SMILES for 4-[5-(2-phenylethyl)-1H-1,2,4-triazol-3-yl]aniline is Nc1ccc(-c2n[nH]c(CCc3ccccc3)n2)cc1.
What is the InChIKey of 4-[5-(2-phenylethyl)-1H-1,2,4-triazol-3-yl]aniline?
The InChIKey is PLGXZEAIABQIIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N4/c17-14-9-7-13(8-10-14)16-18-15(19-20-16)11-6-12-4-2-1-3-5-12/h1-5,7-10H,6,11,17H2,(H,18,19,20).
What are the key properties of 4-[5-(2-phenylethyl)-1H-1,2,4-triazol-3-yl]aniline?
4-[5-(2-phenylethyl)-1H-1,2,4-triazol-3-yl]aniline has a molecular weight of 264.33 g/mol, XLogP of 2.84, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(2-phenylethyl)-1H-1,2,4-triazol-3-yl]aniline is sourced from PubChem (CID 82568521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).