C17H17N3 — CID 62504307
5-[2-(4-methylphenyl)ethyl]-3-phenyl-1H-1,2,4-triazole (PubChem CID 62504307) has the molecular formula C17H17N3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 5-[2-(4-methylphenyl)ethyl]-3-phenyl-1H-1,2,4-triazole.
| Compound Name | 5-[2-(4-methylphenyl)ethyl]-3-phenyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 62504307 |
| Molecular Formula | C17H17N3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 5-[2-(4-methylphenyl)ethyl]-3-phenyl-1H-1,2,4-triazole |
| SMILES | Cc1ccc(CCc2nc(-c3ccccc3)n[nH]2)cc1 |
| InChI | InChI=1S/C17H17N3/c1-13-7-9-14(10-8-13)11-12-16-18-17(20-19-16)15-5-3-2-4-6-15/h2-10H,11-12H2,1H3,(H,18,19,20) |
| InChIKey | VGRPDBSZIZGDAG-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |