About [5-(cyclohexylmethyl)-1H-1,2,4-triazol-3-yl]imino-dimethyl-oxo-λ6-sulfane
[5-(cyclohexylmethyl)-1H-1,2,4-triazol-3-yl]imino-dimethyl-oxo-λ6-sulfane (PubChem CID 167930575) has the molecular formula C11H20N4OS
and a molecular weight of 256.37 g/mol. Its IUPAC name is [5-(cyclohexylmethyl)-1H-1,2,4-triazol-3-yl]imino-dimethyl-oxo-λ6-sulfane.
Molecular Properties
| Compound Name | [5-(cyclohexylmethyl)-1H-1,2,4-triazol-3-yl]imino-dimethyl-oxo-λ6-sulfane |
| PubChem CID | 167930575 |
| Molecular Formula | C11H20N4OS |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | [5-(cyclohexylmethyl)-1H-1,2,4-triazol-3-yl]imino-dimethyl-oxo-λ6-sulfane |
| SMILES | CS(C)(=O)=Nc1n[nH]c(CC2CCCCC2)n1 |
| InChI | InChI=1S/C11H20N4OS/c1-17(2,16)15-11-12-10(13-14-11)8-9-6-4-3-5-7-9/h9H,3-8H2,1-2H3,(H,12,13,14) |
| InChIKey | PBOGINMTMOHFRM-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-(cyclohexylmethyl)-1H-1,2,4-triazol-3-yl]imino-dimethyl-oxo-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(cyclohexylmethyl)-1H-1,2,4-triazol-3-yl]imino-dimethyl-oxo-λ6-sulfane?
The IUPAC name of [5-(cyclohexylmethyl)-1H-1,2,4-triazol-3-yl]imino-dimethyl-oxo-λ6-sulfane (CID 167930575) is [5-(cyclohexylmethyl)-1H-1,2,4-triazol-3-yl]imino-dimethyl-oxo-λ6-sulfane.
What is the SMILES notation for [5-(cyclohexylmethyl)-1H-1,2,4-triazol-3-yl]imino-dimethyl-oxo-λ6-sulfane?
The canonical SMILES for [5-(cyclohexylmethyl)-1H-1,2,4-triazol-3-yl]imino-dimethyl-oxo-λ6-sulfane is CS(C)(=O)=Nc1n[nH]c(CC2CCCCC2)n1.
What is the InChIKey of [5-(cyclohexylmethyl)-1H-1,2,4-triazol-3-yl]imino-dimethyl-oxo-λ6-sulfane?
The InChIKey is PBOGINMTMOHFRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4OS/c1-17(2,16)15-11-12-10(13-14-11)8-9-6-4-3-5-7-9/h9H,3-8H2,1-2H3,(H,12,13,14).
What are the key properties of [5-(cyclohexylmethyl)-1H-1,2,4-triazol-3-yl]imino-dimethyl-oxo-λ6-sulfane?
[5-(cyclohexylmethyl)-1H-1,2,4-triazol-3-yl]imino-dimethyl-oxo-λ6-sulfane has a molecular weight of 256.37 g/mol, XLogP of 2.29, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(cyclohexylmethyl)-1H-1,2,4-triazol-3-yl]imino-dimethyl-oxo-λ6-sulfane is sourced from PubChem (CID 167930575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).