C13H23N5 — CID 102792902
1-[5-(cyclohexylmethyl)-1H-1,2,4-triazol-3-yl]piperazine (PubChem CID 102792902) has the molecular formula C13H23N5 and a molecular weight of 249.36 g/mol. Its IUPAC name is 1-[5-(cyclohexylmethyl)-1H-1,2,4-triazol-3-yl]piperazine.
| Compound Name | 1-[5-(cyclohexylmethyl)-1H-1,2,4-triazol-3-yl]piperazine |
|---|---|
| PubChem CID | 102792902 |
| Molecular Formula | C13H23N5 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.20 |
| IUPAC Name | 1-[5-(cyclohexylmethyl)-1H-1,2,4-triazol-3-yl]piperazine |
| SMILES | C1CCC(Cc2nc(N3CCNCC3)n[nH]2)CC1 |
| InChI | InChI=1S/C13H23N5/c1-2-4-11(5-3-1)10-12-15-13(17-16-12)18-8-6-14-7-9-18/h11,14H,1-10H2,(H,15,16,17) |
| InChIKey | LZFWFUZSVHBHME-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |