C7H12N4O2 — CID 61347310
5-(3-amino-1H-1,2,4-triazol-5-yl)pentanoic acid (PubChem CID 61347310) has the molecular formula C7H12N4O2 and a molecular weight of 184.20 g/mol. Its IUPAC name is 5-(3-amino-1H-1,2,4-triazol-5-yl)pentanoic acid.
| Compound Name | 5-(3-amino-1H-1,2,4-triazol-5-yl)pentanoic acid |
|---|---|
| PubChem CID | 61347310 |
| Molecular Formula | C7H12N4O2 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 5-(3-amino-1H-1,2,4-triazol-5-yl)pentanoic acid |
| SMILES | Nc1n[nH]c(CCCCC(=O)O)n1 |
| InChI | InChI=1S/C7H12N4O2/c8-7-9-5(10-11-7)3-1-2-4-6(12)13/h1-4H2,(H,12,13)(H3,8,9,10,11) |
| InChIKey | NIKLTQGUCFEXGW-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|