C10H17N3O2 — CID 61346928
5-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)pentanoic acid (PubChem CID 61346928) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is 5-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)pentanoic acid.
| Compound Name | 5-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)pentanoic acid |
|---|---|
| PubChem CID | 61346928 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 5-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)pentanoic acid |
| SMILES | CC(C)c1n[nH]c(CCCCC(=O)O)n1 |
| InChI | InChI=1S/C10H17N3O2/c1-7(2)10-11-8(12-13-10)5-3-4-6-9(14)15/h7H,3-6H2,1-2H3,(H,14,15)(H,11,12,13) |
| InChIKey | RHWXWNJADVRDFQ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|