C11H25N3 — CID 153344049
ethane;5-ethyl-3-propan-2-yl-1H-1,2,4-triazole (PubChem CID 153344049) has the molecular formula C11H25N3 and a molecular weight of 199.34 g/mol. Its IUPAC name is ethane;5-ethyl-3-propan-2-yl-1H-1,2,4-triazole.
| Compound Name | ethane;5-ethyl-3-propan-2-yl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 153344049 |
| Molecular Formula | C11H25N3 |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.20 |
| IUPAC Name | ethane;5-ethyl-3-propan-2-yl-1H-1,2,4-triazole |
| SMILES | CC.CC.CCc1nc(C(C)C)n[nH]1 |
| InChI | InChI=1S/C7H13N3.2C2H6/c1-4-6-8-7(5(2)3)10-9-6;2*1-2/h5H,4H2,1-3H3,(H,8,9,10);2*1-2H3 |
| InChIKey | MFKYOOWTHPIHJX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |