About 3,5-di(propan-2-yl)-1H-1,2,4-triazole;molecular hydrogen
3,5-di(propan-2-yl)-1H-1,2,4-triazole;molecular hydrogen (PubChem CID 154652840) has the molecular formula C8H17N3
and a molecular weight of 155.25 g/mol. Its IUPAC name is 3,5-di(propan-2-yl)-1H-1,2,4-triazole;molecular hydrogen.
Analyze 3,5-di(propan-2-yl)-1H-1,2,4-triazole;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-di(propan-2-yl)-1H-1,2,4-triazole;molecular hydrogen?
The IUPAC name of 3,5-di(propan-2-yl)-1H-1,2,4-triazole;molecular hydrogen (CID 154652840) is 3,5-di(propan-2-yl)-1H-1,2,4-triazole;molecular hydrogen.
What is the SMILES notation for 3,5-di(propan-2-yl)-1H-1,2,4-triazole;molecular hydrogen?
The canonical SMILES for 3,5-di(propan-2-yl)-1H-1,2,4-triazole;molecular hydrogen is CC(C)c1n[nH]c(C(C)C)n1.[H][H].
What is the InChIKey of 3,5-di(propan-2-yl)-1H-1,2,4-triazole;molecular hydrogen?
The InChIKey is QLESLYMPCDEFRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3.H2/c1-5(2)7-9-8(6(3)4)11-10-7;/h5-6H,1-4H3,(H,9,10,11);1H.
What are the key properties of 3,5-di(propan-2-yl)-1H-1,2,4-triazole;molecular hydrogen?
3,5-di(propan-2-yl)-1H-1,2,4-triazole;molecular hydrogen has a molecular weight of 155.25 g/mol, XLogP of 2.30, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-di(propan-2-yl)-1H-1,2,4-triazole;molecular hydrogen is sourced from PubChem (CID 154652840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).