About 3-(3-amino-1H-1,2,4-triazol-5-yl)-1-piperazin-1-ylpropan-1-one
3-(3-amino-1H-1,2,4-triazol-5-yl)-1-piperazin-1-ylpropan-1-one (PubChem CID 82509691) has the molecular formula C9H16N6O
and a molecular weight of 224.27 g/mol. Its IUPAC name is 3-(3-amino-1H-1,2,4-triazol-5-yl)-1-piperazin-1-ylpropan-1-one.
Molecular Properties
| Compound Name | 3-(3-amino-1H-1,2,4-triazol-5-yl)-1-piperazin-1-ylpropan-1-one |
| PubChem CID | 82509691 |
| Molecular Formula | C9H16N6O |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 3-(3-amino-1H-1,2,4-triazol-5-yl)-1-piperazin-1-ylpropan-1-one |
| SMILES | Nc1n[nH]c(CCC(=O)N2CCNCC2)n1 |
| InChI | InChI=1S/C9H16N6O/c10-9-12-7(13-14-9)1-2-8(16)15-5-3-11-4-6-15/h11H,1-6H2,(H3,10,12,13,14) |
| InChIKey | BURWLLXFIVJNKR-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(3-amino-1H-1,2,4-triazol-5-yl)-1-piperazin-1-ylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-amino-1H-1,2,4-triazol-5-yl)-1-piperazin-1-ylpropan-1-one?
The IUPAC name of 3-(3-amino-1H-1,2,4-triazol-5-yl)-1-piperazin-1-ylpropan-1-one (CID 82509691) is 3-(3-amino-1H-1,2,4-triazol-5-yl)-1-piperazin-1-ylpropan-1-one.
What is the SMILES notation for 3-(3-amino-1H-1,2,4-triazol-5-yl)-1-piperazin-1-ylpropan-1-one?
The canonical SMILES for 3-(3-amino-1H-1,2,4-triazol-5-yl)-1-piperazin-1-ylpropan-1-one is Nc1n[nH]c(CCC(=O)N2CCNCC2)n1.
What is the InChIKey of 3-(3-amino-1H-1,2,4-triazol-5-yl)-1-piperazin-1-ylpropan-1-one?
The InChIKey is BURWLLXFIVJNKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N6O/c10-9-12-7(13-14-9)1-2-8(16)15-5-3-11-4-6-15/h11H,1-6H2,(H3,10,12,13,14).
What are the key properties of 3-(3-amino-1H-1,2,4-triazol-5-yl)-1-piperazin-1-ylpropan-1-one?
3-(3-amino-1H-1,2,4-triazol-5-yl)-1-piperazin-1-ylpropan-1-one has a molecular weight of 224.27 g/mol, XLogP of -1.25, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-amino-1H-1,2,4-triazol-5-yl)-1-piperazin-1-ylpropan-1-one is sourced from PubChem (CID 82509691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).