C13H17ClN4O — CID 119402326
2-(2H-indazol-3-yl)-1-piperazin-1-ylethanone;hydrochloride (PubChem CID 119402326) has the molecular formula C13H17ClN4O and a molecular weight of 280.76 g/mol. Its IUPAC name is 2-(2H-indazol-3-yl)-1-piperazin-1-ylethanone;hydrochloride.
| Compound Name | 2-(2H-indazol-3-yl)-1-piperazin-1-ylethanone;hydrochloride |
|---|---|
| PubChem CID | 119402326 |
| Molecular Formula | C13H17ClN4O |
| Molecular Weight | 280.76 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 2-(2H-indazol-3-yl)-1-piperazin-1-ylethanone;hydrochloride |
| SMILES | Cl.O=C(Cc1[nH]nc2ccccc12)N1CCNCC1 |
| InChI | InChI=1S/C13H16N4O.ClH/c18-13(17-7-5-14-6-8-17)9-12-10-3-1-2-4-11(10)15-16-12;/h1-4,14H,5-9H2,(H,15,16);1H |
| InChIKey | NTEHHAAVRXGYII-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.76 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |