C17H24N4O — CID 119646692
1-[4-(ethylaminomethyl)piperidin-1-yl]-2-(2H-indazol-3-yl)ethanone (PubChem CID 119646692) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is 1-[4-(ethylaminomethyl)piperidin-1-yl]-2-(2H-indazol-3-yl)ethanone.
| Compound Name | 1-[4-(ethylaminomethyl)piperidin-1-yl]-2-(2H-indazol-3-yl)ethanone |
|---|---|
| PubChem CID | 119646692 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 1-[4-(ethylaminomethyl)piperidin-1-yl]-2-(2H-indazol-3-yl)ethanone |
| SMILES | CCNCC1CCN(C(=O)Cc2[nH]nc3ccccc23)CC1 |
| InChI | InChI=1S/C17H24N4O/c1-2-18-12-13-7-9-21(10-8-13)17(22)11-16-14-5-3-4-6-15(14)19-20-16/h3-6,13,18H,2,7-12H2,1H3,(H,19,20) |
| InChIKey | SEDFHSJJIOLVDS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |