C17H26BrClN2O — CID 119647509
3-(2-bromophenyl)-1-[4-(ethylaminomethyl)piperidin-1-yl]propan-1-one;hydrochloride (PubChem CID 119647509) has the molecular formula C17H26BrClN2O and a molecular weight of 389.77 g/mol. Its IUPAC name is 3-(2-bromophenyl)-1-[4-(ethylaminomethyl)piperidin-1-yl]propan-1-one;hydrochloride.
| Compound Name | 3-(2-bromophenyl)-1-[4-(ethylaminomethyl)piperidin-1-yl]propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119647509 |
| Molecular Formula | C17H26BrClN2O |
| Molecular Weight | 389.77 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 3-(2-bromophenyl)-1-[4-(ethylaminomethyl)piperidin-1-yl]propan-1-one;hydrochloride |
| SMILES | CCNCC1CCN(C(=O)CCc2ccccc2Br)CC1.Cl |
| InChI | InChI=1S/C17H25BrN2O.ClH/c1-2-19-13-14-9-11-20(12-10-14)17(21)8-7-15-5-3-4-6-16(15)18;/h3-6,14,19H,2,7-13H2,1H3;1H |
| InChIKey | KHGXLJPJFKGUDA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.77 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |