C19H20Cl2N4O — CID 120803044
1-[2-(3-chlorophenyl)piperazin-1-yl]-2-(2H-indazol-3-yl)ethanone;hydrochloride (PubChem CID 120803044) has the molecular formula C19H20Cl2N4O and a molecular weight of 391.30 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)piperazin-1-yl]-2-(2H-indazol-3-yl)ethanone;hydrochloride.
| Compound Name | 1-[2-(3-chlorophenyl)piperazin-1-yl]-2-(2H-indazol-3-yl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 120803044 |
| Molecular Formula | C19H20Cl2N4O |
| Molecular Weight | 391.30 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 1-[2-(3-chlorophenyl)piperazin-1-yl]-2-(2H-indazol-3-yl)ethanone;hydrochloride |
| SMILES | Cl.O=C(Cc1[nH]nc2ccccc12)N1CCNCC1c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H19ClN4O.ClH/c20-14-5-3-4-13(10-14)18-12-21-8-9-24(18)19(25)11-17-15-6-1-2-7-16(15)22-23-17;/h1-7,10,18,21H,8-9,11-12H2,(H,22,23);1H |
| InChIKey | CJTQTXPOIOSPLJ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.30 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |