C7H10N2O3S — CID 22759402
5-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)pentanoic acid (PubChem CID 22759402) has the molecular formula C7H10N2O3S and a molecular weight of 202.23 g/mol. Its IUPAC name is 5-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)pentanoic acid.
| Compound Name | 5-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)pentanoic acid |
|---|---|
| PubChem CID | 22759402 |
| Molecular Formula | C7H10N2O3S |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | 5-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)pentanoic acid |
| SMILES | O=C(O)CCCCc1n[nH]c(=S)o1 |
| InChI | InChI=1S/C7H10N2O3S/c10-6(11)4-2-1-3-5-8-9-7(13)12-5/h1-4H2,(H,9,13)(H,10,11) |
| InChIKey | IXCINKGKBZYKDY-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|