C13H13N3O2S — CID 95477969
5-[3-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)propyl]-1,3-dihydroindol-2-one (PubChem CID 95477969) has the molecular formula C13H13N3O2S and a molecular weight of 275.33 g/mol. Its IUPAC name is 5-[3-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)propyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[3-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)propyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 95477969 |
| Molecular Formula | C13H13N3O2S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 5-[3-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)propyl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(CCCc3n[nH]c(=S)o3)ccc2N1 |
| InChI | InChI=1S/C13H13N3O2S/c17-11-7-9-6-8(4-5-10(9)14-11)2-1-3-12-15-16-13(19)18-12/h4-6H,1-3,7H2,(H,14,17)(H,16,19) |
| InChIKey | XYTCWIDWJLEHTL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|