C6H10N2O4S2 — CID 22749190
4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)butane-1-sulfonic acid (PubChem CID 22749190) has the molecular formula C6H10N2O4S2 and a molecular weight of 238.29 g/mol. Its IUPAC name is 4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)butane-1-sulfonic acid.
| Compound Name | 4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)butane-1-sulfonic acid |
|---|---|
| PubChem CID | 22749190 |
| Molecular Formula | C6H10N2O4S2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.01 |
| IUPAC Name | 4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)butane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCCc1n[nH]c(=S)o1 |
| InChI | InChI=1S/C6H10N2O4S2/c9-14(10,11)4-2-1-3-5-7-8-6(13)12-5/h1-4H2,(H,8,13)(H,9,10,11) |
| InChIKey | FLFPEYQGUOVYPC-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|