C19H28N2O3S — CID 139225495
5-[10-[4-(hydroxymethyl)phenoxy]decyl]-3H-1,3,4-oxadiazole-2-thione (PubChem CID 139225495) has the molecular formula C19H28N2O3S and a molecular weight of 364.51 g/mol. Its IUPAC name is 5-[10-[4-(hydroxymethyl)phenoxy]decyl]-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-[10-[4-(hydroxymethyl)phenoxy]decyl]-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 139225495 |
| Molecular Formula | C19H28N2O3S |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 5-[10-[4-(hydroxymethyl)phenoxy]decyl]-3H-1,3,4-oxadiazole-2-thione |
| SMILES | OCc1ccc(OCCCCCCCCCCc2n[nH]c(=S)o2)cc1 |
| InChI | InChI=1S/C19H28N2O3S/c22-15-16-10-12-17(13-11-16)23-14-8-6-4-2-1-3-5-7-9-18-20-21-19(25)24-18/h10-13,22H,1-9,14-15H2,(H,21,25) |
| InChIKey | SWACAGCIKIMRLZ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 71.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|