C11H20N2OS — CID 10988022
5-nonyl-3H-1,3,4-oxadiazole-2-thione (PubChem CID 10988022) has the molecular formula C11H20N2OS and a molecular weight of 228.36 g/mol. Its IUPAC name is 5-nonyl-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-nonyl-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 10988022 |
| Molecular Formula | C11H20N2OS |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 5-nonyl-3H-1,3,4-oxadiazole-2-thione |
| SMILES | CCCCCCCCCc1n[nH]c(=S)o1 |
| InChI | InChI=1S/C11H20N2OS/c1-2-3-4-5-6-7-8-9-10-12-13-11(15)14-10/h2-9H2,1H3,(H,13,15) |
| InChIKey | SIOPKKJUJKKXPU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|