C29H25N9O3S — CID 20766394
methyl [4,6-bis(4-phenyldiazenylanilino)-1,3,5-triazin-2-yl]methanesulfonate (PubChem CID 20766394) has the molecular formula C29H25N9O3S and a molecular weight of 579.65 g/mol. Its IUPAC name is methyl [4,6-bis(4-phenyldiazenylanilino)-1,3,5-triazin-2-yl]methanesulfonate.
| Compound Name | methyl [4,6-bis(4-phenyldiazenylanilino)-1,3,5-triazin-2-yl]methanesulfonate |
|---|---|
| PubChem CID | 20766394 |
| Molecular Formula | C29H25N9O3S |
| Molecular Weight | 579.65 g/mol |
| Exact Mass | 579.18 |
| IUPAC Name | methyl [4,6-bis(4-phenyldiazenylanilino)-1,3,5-triazin-2-yl]methanesulfonate |
| SMILES | COS(=O)(=O)Cc1nc(Nc2ccc(/N=N/c3ccccc3)cc2)nc(Nc2ccc(/N=N/c3ccccc3)cc2)n1 |
| InChI | InChI=1S/C29H25N9O3S/c1-41-42(39,40)20-27-32-28(30-21-12-16-25(17-13-21)37-35-23-8-4-2-5-9-23)34-29(33-27)31-22-14-18-26(19-15-22)38-36-24-10-6-3-7-11-24/h2-19H,20H2,1H3,(H2,30,31,32,33,34)/b37-35+,38-36+ |
| InChIKey | VAJYZBPJLZZWLC-ATXIYDNESA-N |
| XLogP | 7.67 |
| TPSA | 155.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.65 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|