C35H36N10O — CID 20762407
2-N,4-N-bis[4-[(3,5-dimethylphenyl)diazenyl]phenyl]-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine (PubChem CID 20762407) has the molecular formula C35H36N10O and a molecular weight of 612.74 g/mol. Its IUPAC name is 2-N,4-N-bis[4-[(3,5-dimethylphenyl)diazenyl]phenyl]-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,4-N-bis[4-[(3,5-dimethylphenyl)diazenyl]phenyl]-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 20762407 |
| Molecular Formula | C35H36N10O |
| Molecular Weight | 612.74 g/mol |
| Exact Mass | 612.31 |
| IUPAC Name | 2-N,4-N-bis[4-[(3,5-dimethylphenyl)diazenyl]phenyl]-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1cc(C)cc(/N=N/c2ccc(Nc3nc(Nc4ccc(/N=N/c5cc(C)cc(C)c5)cc4)nc(N4CCOCC4)n3)cc2)c1 |
| InChI | InChI=1S/C35H36N10O/c1-23-17-24(2)20-31(19-23)43-41-29-9-5-27(6-10-29)36-33-38-34(40-35(39-33)45-13-15-46-16-14-45)37-28-7-11-30(12-8-28)42-44-32-21-25(3)18-26(4)22-32/h5-12,17-22H,13-16H2,1-4H3,(H2,36,37,38,39,40)/b43-41+,44-42+ |
| InChIKey | YTUNAHYFSCHUQN-CHQNLTHESA-N |
| XLogP | 9.26 |
| TPSA | 124.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.74 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|