C14H15N3O3 — CID 108778109
methyl 4-[(4,6-dimethylpyrimidin-2-yl)amino]-3-hydroxybenzoate (PubChem CID 108778109) has the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. Its IUPAC name is methyl 4-[(4,6-dimethylpyrimidin-2-yl)amino]-3-hydroxybenzoate.
| Compound Name | methyl 4-[(4,6-dimethylpyrimidin-2-yl)amino]-3-hydroxybenzoate |
|---|---|
| PubChem CID | 108778109 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | methyl 4-[(4,6-dimethylpyrimidin-2-yl)amino]-3-hydroxybenzoate |
| SMILES | COC(=O)c1ccc(Nc2nc(C)cc(C)n2)c(O)c1 |
| InChI | InChI=1S/C14H15N3O3/c1-8-6-9(2)16-14(15-8)17-11-5-4-10(7-12(11)18)13(19)20-3/h4-7,18H,1-3H3,(H,15,16,17) |
| InChIKey | IUSCAVUPPGMGSE-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|