C20H19N3O3 — CID 108778108
methyl 3-hydroxy-4-[[2-methyl-6-(4-methylphenyl)pyrimidin-4-yl]amino]benzoate (PubChem CID 108778108) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is methyl 3-hydroxy-4-[[2-methyl-6-(4-methylphenyl)pyrimidin-4-yl]amino]benzoate.
| Compound Name | methyl 3-hydroxy-4-[[2-methyl-6-(4-methylphenyl)pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 108778108 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | methyl 3-hydroxy-4-[[2-methyl-6-(4-methylphenyl)pyrimidin-4-yl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Nc2cc(-c3ccc(C)cc3)nc(C)n2)c(O)c1 |
| InChI | InChI=1S/C20H19N3O3/c1-12-4-6-14(7-5-12)17-11-19(22-13(2)21-17)23-16-9-8-15(10-18(16)24)20(25)26-3/h4-11,24H,1-3H3,(H,21,22,23) |
| InChIKey | QWMCMNTVSQORNN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|