C19H19Cl2N3O — CID 52986012
N-(5-chloro-2-methoxyphenyl)-2-methyl-6-(4-methylphenyl)pyrimidin-4-amine;hydrochloride (PubChem CID 52986012) has the molecular formula C19H19Cl2N3O and a molecular weight of 376.29 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-2-methyl-6-(4-methylphenyl)pyrimidin-4-amine;hydrochloride.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-2-methyl-6-(4-methylphenyl)pyrimidin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 52986012 |
| Molecular Formula | C19H19Cl2N3O |
| Molecular Weight | 376.29 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-2-methyl-6-(4-methylphenyl)pyrimidin-4-amine;hydrochloride |
| SMILES | COc1ccc(Cl)cc1Nc1cc(-c2ccc(C)cc2)nc(C)n1.Cl |
| InChI | InChI=1S/C19H18ClN3O.ClH/c1-12-4-6-14(7-5-12)16-11-19(22-13(2)21-16)23-17-10-15(20)8-9-18(17)24-3;/h4-11H,1-3H3,(H,21,22,23);1H |
| InChIKey | MFZRYTKMBYXIQU-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.29 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |