C18H17ClN2O — CID 740915
N-(5-chloro-2-methoxyphenyl)-4,6-dimethylquinolin-2-amine (PubChem CID 740915) has the molecular formula C18H17ClN2O and a molecular weight of 312.80 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-4,6-dimethylquinolin-2-amine.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-4,6-dimethylquinolin-2-amine |
|---|---|
| PubChem CID | 740915 |
| Molecular Formula | C18H17ClN2O |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-4,6-dimethylquinolin-2-amine |
| SMILES | COc1ccc(Cl)cc1Nc1cc(C)c2cc(C)ccc2n1 |
| InChI | InChI=1S/C18H17ClN2O/c1-11-4-6-15-14(8-11)12(2)9-18(20-15)21-16-10-13(19)5-7-17(16)22-3/h4-10H,1-3H3,(H,20,21) |
| InChIKey | HLWMLYNEZWIYMO-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |