C21H21N3O3 — CID 108778120
methyl 4-[(5-benzyl-2,6-dimethylpyrimidin-4-yl)amino]-3-hydroxybenzoate (PubChem CID 108778120) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is methyl 4-[(5-benzyl-2,6-dimethylpyrimidin-4-yl)amino]-3-hydroxybenzoate.
| Compound Name | methyl 4-[(5-benzyl-2,6-dimethylpyrimidin-4-yl)amino]-3-hydroxybenzoate |
|---|---|
| PubChem CID | 108778120 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | methyl 4-[(5-benzyl-2,6-dimethylpyrimidin-4-yl)amino]-3-hydroxybenzoate |
| SMILES | COC(=O)c1ccc(Nc2nc(C)nc(C)c2Cc2ccccc2)c(O)c1 |
| InChI | InChI=1S/C21H21N3O3/c1-13-17(11-15-7-5-4-6-8-15)20(23-14(2)22-13)24-18-10-9-16(12-19(18)25)21(26)27-3/h4-10,12,25H,11H2,1-3H3,(H,22,23,24) |
| InChIKey | AJEHEBSPAQULJB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|