C15H14N3NaO5 — CID 139615019
sodium 2-[(4,6-dimethoxypyrimidine-2-carbonyl)amino]-5-methylbenzoate (PubChem CID 139615019) has the molecular formula C15H14N3NaO5 and a molecular weight of 339.28 g/mol. Its IUPAC name is sodium 2-[(4,6-dimethoxypyrimidine-2-carbonyl)amino]-5-methylbenzoate.
| Compound Name | sodium 2-[(4,6-dimethoxypyrimidine-2-carbonyl)amino]-5-methylbenzoate |
|---|---|
| PubChem CID | 139615019 |
| Molecular Formula | C15H14N3NaO5 |
| Molecular Weight | 339.28 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | sodium 2-[(4,6-dimethoxypyrimidine-2-carbonyl)amino]-5-methylbenzoate |
| SMILES | COc1cc(OC)nc(C(=O)Nc2ccc(C)cc2C(=O)[O-])n1.[Na+] |
| InChI | InChI=1S/C15H15N3O5.Na/c1-8-4-5-10(9(6-8)15(20)21)16-14(19)13-17-11(22-2)7-12(18-13)23-3;/h4-7H,1-3H3,(H,16,19)(H,20,21);/q;+1/p-1 |
| InChIKey | AKPWSPLUGYROBS-UHFFFAOYSA-M |
| XLogP | -2.58 |
| TPSA | 113.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.28 |
| LogP ≤ 5 | -2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |