C9H15N3O5S — CID 159487000
4,6-dimethoxy-N-methylsulfonylpyrimidine-2-carboxamide;methane (PubChem CID 159487000) has the molecular formula C9H15N3O5S and a molecular weight of 277.30 g/mol. Its IUPAC name is 4,6-dimethoxy-N-methylsulfonylpyrimidine-2-carboxamide;methane.
| Compound Name | 4,6-dimethoxy-N-methylsulfonylpyrimidine-2-carboxamide;methane |
|---|---|
| PubChem CID | 159487000 |
| Molecular Formula | C9H15N3O5S |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 4,6-dimethoxy-N-methylsulfonylpyrimidine-2-carboxamide;methane |
| SMILES | C.COc1cc(OC)nc(C(=O)NS(C)(=O)=O)n1 |
| InChI | InChI=1S/C8H11N3O5S.CH4/c1-15-5-4-6(16-2)10-7(9-5)8(12)11-17(3,13)14;/h4H,1-3H3,(H,11,12);1H4 |
| InChIKey | LXRZQRDCRZGKHX-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |