C14H12F2N2O5S — CID 66666992
2,5-difluoro-4-[(6-methoxy-3-pyridinyl)oxy]-N-methylsulfonylbenzamide (PubChem CID 66666992) has the molecular formula C14H12F2N2O5S and a molecular weight of 358.32 g/mol. Its IUPAC name is 2,5-difluoro-4-[(6-methoxy-3-pyridinyl)oxy]-N-methylsulfonylbenzamide.
| Compound Name | 2,5-difluoro-4-[(6-methoxy-3-pyridinyl)oxy]-N-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 66666992 |
| Molecular Formula | C14H12F2N2O5S |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 2,5-difluoro-4-[(6-methoxy-3-pyridinyl)oxy]-N-methylsulfonylbenzamide |
| SMILES | COc1ccc(Oc2cc(F)c(C(=O)NS(C)(=O)=O)cc2F)cn1 |
| InChI | InChI=1S/C14H12F2N2O5S/c1-22-13-4-3-8(7-17-13)23-12-6-10(15)9(5-11(12)16)14(19)18-24(2,20)21/h3-7H,1-2H3,(H,18,19) |
| InChIKey | UPZBOXXDBPJJLJ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |