C15H11Cl2F2NO4S — CID 66667669
4-[(3,4-dichlorophenoxy)methyl]-2,5-difluoro-N-methylsulfonylbenzamide (PubChem CID 66667669) has the molecular formula C15H11Cl2F2NO4S and a molecular weight of 410.23 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenoxy)methyl]-2,5-difluoro-N-methylsulfonylbenzamide.
| Compound Name | 4-[(3,4-dichlorophenoxy)methyl]-2,5-difluoro-N-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 66667669 |
| Molecular Formula | C15H11Cl2F2NO4S |
| Molecular Weight | 410.23 g/mol |
| Exact Mass | 408.98 |
| IUPAC Name | 4-[(3,4-dichlorophenoxy)methyl]-2,5-difluoro-N-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)NC(=O)c1cc(F)c(COc2ccc(Cl)c(Cl)c2)cc1F |
| InChI | InChI=1S/C15H11Cl2F2NO4S/c1-25(22,23)20-15(21)10-6-13(18)8(4-14(10)19)7-24-9-2-3-11(16)12(17)5-9/h2-6H,7H2,1H3,(H,20,21) |
| InChIKey | RQIRAWYTRPXHHW-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.23 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |