C14H9Cl2F2NO4S — CID 66667432
4-(2,3-dichlorophenoxy)-2,5-difluoro-N-methylsulfonylbenzamide (PubChem CID 66667432) has the molecular formula C14H9Cl2F2NO4S and a molecular weight of 396.20 g/mol. Its IUPAC name is 4-(2,3-dichlorophenoxy)-2,5-difluoro-N-methylsulfonylbenzamide.
| Compound Name | 4-(2,3-dichlorophenoxy)-2,5-difluoro-N-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 66667432 |
| Molecular Formula | C14H9Cl2F2NO4S |
| Molecular Weight | 396.20 g/mol |
| Exact Mass | 394.96 |
| IUPAC Name | 4-(2,3-dichlorophenoxy)-2,5-difluoro-N-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)NC(=O)c1cc(F)c(Oc2cccc(Cl)c2Cl)cc1F |
| InChI | InChI=1S/C14H9Cl2F2NO4S/c1-24(21,22)19-14(20)7-5-10(18)12(6-9(7)17)23-11-4-2-3-8(15)13(11)16/h2-6H,1H3,(H,19,20) |
| InChIKey | YSDKPXKXUINEQG-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.20 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |