C16H19ClFNO4S — CID 91809358
4-(2-bicyclo[2.2.1]heptanylmethoxy)-5-chloro-2-fluoro-N-methylsulfonylbenzamide (PubChem CID 91809358) has the molecular formula C16H19ClFNO4S and a molecular weight of 375.85 g/mol. Its IUPAC name is 4-(2-bicyclo[2.2.1]heptanylmethoxy)-5-chloro-2-fluoro-N-methylsulfonylbenzamide.
| Compound Name | 4-(2-bicyclo[2.2.1]heptanylmethoxy)-5-chloro-2-fluoro-N-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 91809358 |
| Molecular Formula | C16H19ClFNO4S |
| Molecular Weight | 375.85 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | 4-(2-bicyclo[2.2.1]heptanylmethoxy)-5-chloro-2-fluoro-N-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)NC(=O)c1cc(Cl)c(OCC2CC3CCC2C3)cc1F |
| InChI | InChI=1S/C16H19ClFNO4S/c1-24(21,22)19-16(20)12-6-13(17)15(7-14(12)18)23-8-11-5-9-2-3-10(11)4-9/h6-7,9-11H,2-5,8H2,1H3,(H,19,20) |
| InChIKey | CDOTYXYWRXPXRN-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.85 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |