C19H26ClFN2O4S — CID 86702851
5-chloro-N-(dimethylsulfamoyl)-2-fluoro-4-(spiro[3.5]nonan-7-ylmethoxy)benzamide (PubChem CID 86702851) has the molecular formula C19H26ClFN2O4S and a molecular weight of 432.95 g/mol. Its IUPAC name is 5-chloro-N-(dimethylsulfamoyl)-2-fluoro-4-(spiro[3.5]nonan-7-ylmethoxy)benzamide.
| Compound Name | 5-chloro-N-(dimethylsulfamoyl)-2-fluoro-4-(spiro[3.5]nonan-7-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 86702851 |
| Molecular Formula | C19H26ClFN2O4S |
| Molecular Weight | 432.95 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 5-chloro-N-(dimethylsulfamoyl)-2-fluoro-4-(spiro[3.5]nonan-7-ylmethoxy)benzamide |
| SMILES | CN(C)S(=O)(=O)NC(=O)c1cc(Cl)c(OCC2CCC3(CCC3)CC2)cc1F |
| InChI | InChI=1S/C19H26ClFN2O4S/c1-23(2)28(25,26)22-18(24)14-10-15(20)17(11-16(14)21)27-12-13-4-8-19(9-5-13)6-3-7-19/h10-11,13H,3-9,12H2,1-2H3,(H,22,24) |
| InChIKey | UAXPEPUULZECLU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.95 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |